C6H9N5O2 — CID 162372467
2-amino-1-hydroxy-2,3,4a,5-tetrahydropteridin-4-one (PubChem CID 162372467) has the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-amino-1-hydroxy-2,3,4a,5-tetrahydropteridin-4-one.
| Compound Name | 2-amino-1-hydroxy-2,3,4a,5-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 162372467 |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-amino-1-hydroxy-2,3,4a,5-tetrahydropteridin-4-one |
| SMILES | NC1NC(=O)C2NC=CN=C2N1O |
| InChI | InChI=1S/C6H9N5O2/c7-6-10-5(12)3-4(11(6)13)9-2-1-8-3/h1-3,6,8,13H,7H2,(H,10,12) |
| InChIKey | QEKRDMLJQNXMRM-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |