C21H16F6N2O6 — CID 162372472
4-[1,1,1,3,3,3-hexafluoro-2-(3-nitro-4-prop-2-enoxyphenyl)propan-2-yl]-2-nitro-1-prop-2-enoxybenzene (PubChem CID 162372472) has the molecular formula C21H16F6N2O6 and a molecular weight of 506.36 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-(3-nitro-4-prop-2-enoxyphenyl)propan-2-yl]-2-nitro-1-prop-2-enoxybenzene.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-(3-nitro-4-prop-2-enoxyphenyl)propan-2-yl]-2-nitro-1-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 162372472 |
| Molecular Formula | C21H16F6N2O6 |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(3-nitro-4-prop-2-enoxyphenyl)propan-2-yl]-2-nitro-1-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(C(c2ccc(OCC=C)c([N+](=O)[O-])c2)(C(F)(F)F)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16F6N2O6/c1-3-9-34-17-7-5-13(11-15(17)28(30)31)19(20(22,23)24,21(25,26)27)14-6-8-18(35-10-4-2)16(12-14)29(32)33/h3-8,11-12H,1-2,9-10H2 |
| InChIKey | ZAJFIEHJSOCWSD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|