About N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide
N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide (PubChem CID 162373321) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide.
Molecular Properties
| Compound Name | N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide |
| PubChem CID | 162373321 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide |
| SMILES | O=C(NC1CCNCC1)N1C=CNC1 |
| InChI | InChI=1S/C9H16N4O/c14-9(13-6-5-11-7-13)12-8-1-3-10-4-2-8/h5-6,8,10-11H,1-4,7H2,(H,12,14) |
| InChIKey | OLINMBIJZHATMB-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide?
The IUPAC name of N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide (CID 162373321) is N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide.
What is the SMILES notation for N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide?
The canonical SMILES for N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide is O=C(NC1CCNCC1)N1C=CNC1.
What is the InChIKey of N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide?
The InChIKey is OLINMBIJZHATMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c14-9(13-6-5-11-7-13)12-8-1-3-10-4-2-8/h5-6,8,10-11H,1-4,7H2,(H,12,14).
What are the key properties of N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide?
N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide has a molecular weight of 196.25 g/mol, XLogP of -0.22, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-4-yl-1,2-dihydroimidazole-3-carboxamide is sourced from PubChem (CID 162373321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).