About CID 162375379
CID 162375379 (PubChem CID 162375379) has the molecular formula C12H11N2SSi
and a molecular weight of 243.39 g/mol.
Molecular Properties
| Compound Name | CID 162375379 |
| PubChem CID | 162375379 |
| Molecular Formula | C12H11N2SSi |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | — |
| SMILES | C[C@]1(C#C[Si])CCCc2sc(N)c(C#N)c21 |
| InChI | InChI=1S/C12H11N2SSi/c1-12(5-6-16)4-2-3-9-10(12)8(7-13)11(14)15-9/h2-4,14H2,1H3/t12-/m1/s1 |
| InChIKey | LGYMOJBIQKIWJF-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 162375379 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162375379?
The IUPAC name of CID 162375379 (CID 162375379) is not available.
What is the SMILES notation for CID 162375379?
The canonical SMILES for CID 162375379 is C[C@]1(C#C[Si])CCCc2sc(N)c(C#N)c21.
What is the InChIKey of CID 162375379?
The InChIKey is LGYMOJBIQKIWJF-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H11N2SSi/c1-12(5-6-16)4-2-3-9-10(12)8(7-13)11(14)15-9/h2-4,14H2,1H3/t12-/m1/s1.
What are the key properties of CID 162375379?
CID 162375379 has a molecular weight of 243.39 g/mol, XLogP of 1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162375379 is sourced from PubChem (CID 162375379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).