About ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one
ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one (PubChem CID 162375550) has the molecular formula C12H22F3NO
and a molecular weight of 253.31 g/mol. Its IUPAC name is ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one.
Molecular Properties
| Compound Name | ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one |
| PubChem CID | 162375550 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one |
| SMILES | CC.CC(C)C(=O)/C=C/CN(C)CC(F)(F)F |
| InChI | InChI=1S/C10H16F3NO.C2H6/c1-8(2)9(15)5-4-6-14(3)7-10(11,12)13;1-2/h4-5,8H,6-7H2,1-3H3;1-2H3/b5-4+; |
| InChIKey | SSBKLRKUIUGFOY-FXRZFVDSSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one?
The IUPAC name of ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one (CID 162375550) is ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one.
What is the SMILES notation for ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one?
The canonical SMILES for ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one is CC.CC(C)C(=O)/C=C/CN(C)CC(F)(F)F.
What is the InChIKey of ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one?
The InChIKey is SSBKLRKUIUGFOY-FXRZFVDSSA-N. The full InChI is InChI=1S/C10H16F3NO.C2H6/c1-8(2)9(15)5-4-6-14(3)7-10(11,12)13;1-2/h4-5,8H,6-7H2,1-3H3;1-2H3/b5-4+;.
What are the key properties of ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one?
ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one has a molecular weight of 253.31 g/mol, XLogP of 3.29, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-2-methyl-6-[methyl(2,2,2-trifluoroethyl)amino]hex-4-en-3-one is sourced from PubChem (CID 162375550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).