About (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen
(E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen (PubChem CID 162375667) has the molecular formula C11H22F2N2O
and a molecular weight of 236.31 g/mol. Its IUPAC name is (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen |
| PubChem CID | 162375667 |
| Molecular Formula | C11H22F2N2O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen |
| SMILES | CC.CNC(=O)/C=C/CN1CCC(F)(F)C1.[H][H] |
| InChI | InChI=1S/C9H14F2N2O.C2H6.H2/c1-12-8(14)3-2-5-13-6-4-9(10,11)7-13;1-2;/h2-3H,4-7H2,1H3,(H,12,14);1-2H3;1H/b3-2+;; |
| InChIKey | XHHAEIPRJZLGMO-WTVBWJGASA-N |
| XLogP | 1.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen?
The IUPAC name of (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen (CID 162375667) is (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen.
What is the SMILES notation for (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen?
The canonical SMILES for (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen is CC.CNC(=O)/C=C/CN1CCC(F)(F)C1.[H][H].
What is the InChIKey of (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen?
The InChIKey is XHHAEIPRJZLGMO-WTVBWJGASA-N. The full InChI is InChI=1S/C9H14F2N2O.C2H6.H2/c1-12-8(14)3-2-5-13-6-4-9(10,11)7-13;1-2;/h2-3H,4-7H2,1H3,(H,12,14);1-2H3;1H/b3-2+;;.
What are the key properties of (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen?
(E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen has a molecular weight of 236.31 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-methylbut-2-enamide;ethane;molecular hydrogen is sourced from PubChem (CID 162375667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).