C17H23N3S — CID 162375694
N'-[(4R)-3-cyano-4-methyl-4-prop-1-ynyl-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide;methane (PubChem CID 162375694) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is N'-[(4R)-3-cyano-4-methyl-4-prop-1-ynyl-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide;methane.
| Compound Name | N'-[(4R)-3-cyano-4-methyl-4-prop-1-ynyl-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide;methane |
|---|---|
| PubChem CID | 162375694 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N'-[(4R)-3-cyano-4-methyl-4-prop-1-ynyl-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide;methane |
| SMILES | C.CC#C[C@@]1(C)CCCc2sc(/N=C/N(C)C)c(C#N)c21 |
| InChI | InChI=1S/C16H19N3S.CH4/c1-5-8-16(2)9-6-7-13-14(16)12(10-17)15(20-13)18-11-19(3)4;/h11H,6-7,9H2,1-4H3;1H4/b18-11+;/t16-;/m0./s1 |
| InChIKey | JLHTUXANVRZEPS-GAKYDABDSA-N |
| XLogP | 4.09 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|