C19H29BClNO4 — CID 162377331
4-[3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]morpholine (PubChem CID 162377331) has the molecular formula C19H29BClNO4 and a molecular weight of 381.71 g/mol. Its IUPAC name is 4-[3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]morpholine.
| Compound Name | 4-[3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]morpholine |
|---|---|
| PubChem CID | 162377331 |
| Molecular Formula | C19H29BClNO4 |
| Molecular Weight | 381.71 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 4-[3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]morpholine |
| SMILES | CC1(C)OB(c2cccc(OCCCN3CCOCC3)c2Cl)OC1(C)C |
| InChI | InChI=1S/C19H29BClNO4/c1-18(2)19(3,4)26-20(25-18)15-7-5-8-16(17(15)21)24-12-6-9-22-10-13-23-14-11-22/h5,7-8H,6,9-14H2,1-4H3 |
| InChIKey | MPNFMBVNEKXBBG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.71 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|