C20H20ClN7O5 — CID 162378006
1-(2-chloro-3-pyridinyl)ethyl N-[5-[5-(1,3-dioxolane-2-carbonylamino)-2-pyridinyl]-3-methyltriazol-4-yl]carbamate (PubChem CID 162378006) has the molecular formula C20H20ClN7O5 and a molecular weight of 473.88 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)ethyl N-[5-[5-(1,3-dioxolane-2-carbonylamino)-2-pyridinyl]-3-methyltriazol-4-yl]carbamate.
| Compound Name | 1-(2-chloro-3-pyridinyl)ethyl N-[5-[5-(1,3-dioxolane-2-carbonylamino)-2-pyridinyl]-3-methyltriazol-4-yl]carbamate |
|---|---|
| PubChem CID | 162378006 |
| Molecular Formula | C20H20ClN7O5 |
| Molecular Weight | 473.88 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)ethyl N-[5-[5-(1,3-dioxolane-2-carbonylamino)-2-pyridinyl]-3-methyltriazol-4-yl]carbamate |
| SMILES | CC(OC(=O)Nc1c(-c2ccc(NC(=O)C3OCCO3)cn2)nnn1C)c1cccnc1Cl |
| InChI | InChI=1S/C20H20ClN7O5/c1-11(13-4-3-7-22-16(13)21)33-20(30)25-17-15(26-27-28(17)2)14-6-5-12(10-23-14)24-18(29)19-31-8-9-32-19/h3-7,10-11,19H,8-9H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | ZNXCEETZSMTIOT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|