C13H15F3N2 — CID 162378380
1-methyl-4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-2-(trifluoromethyl)imidazole (PubChem CID 162378380) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 1-methyl-4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-2-(trifluoromethyl)imidazole.
| Compound Name | 1-methyl-4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-2-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 162378380 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-methyl-4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-2-(trifluoromethyl)imidazole |
| SMILES | C=C/C(=C\C=C(C)C)c1cn(C)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H15F3N2/c1-5-10(7-6-9(2)3)11-8-18(4)12(17-11)13(14,15)16/h5-8H,1H2,2-4H3/b10-7+ |
| InChIKey | AFBASBFDIYGLMT-JXMROGBWSA-N |
| XLogP | 3.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|