About ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine
ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine (PubChem CID 162378476) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine.
Molecular Properties
| Compound Name | ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine |
| PubChem CID | 162378476 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine |
| SMILES | C=C/C(OC)=C(\N=C)C(C)C.CC |
| InChI | InChI=1S/C9H15NO.C2H6/c1-6-8(11-5)9(10-4)7(2)3;1-2/h6-7H,1,4H2,2-3,5H3;1-2H3/b9-8+; |
| InChIKey | KNAQVSFKRXHOMN-HRNDJLQDSA-N |
| XLogP | 3.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine?
The IUPAC name of ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine (CID 162378476) is ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine.
What is the SMILES notation for ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine?
The canonical SMILES for ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine is C=C/C(OC)=C(\N=C)C(C)C.CC.
What is the InChIKey of ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine?
The InChIKey is KNAQVSFKRXHOMN-HRNDJLQDSA-N. The full InChI is InChI=1S/C9H15NO.C2H6/c1-6-8(11-5)9(10-4)7(2)3;1-2/h6-7H,1,4H2,2-3,5H3;1-2H3/b9-8+;.
What are the key properties of ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine?
ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine has a molecular weight of 183.29 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(3E)-4-methoxy-2-methylhexa-3,5-dien-3-yl]methanimine is sourced from PubChem (CID 162378476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).