C18H27BN2O4 — CID 162378965
N-cyclohexyl-4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 162378965) has the molecular formula C18H27BN2O4 and a molecular weight of 346.24 g/mol. Its IUPAC name is N-cyclohexyl-4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-cyclohexyl-4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 162378965 |
| Molecular Formula | C18H27BN2O4 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | N-cyclohexyl-4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2cc([N+](=O)[O-])ccc2NC2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C18H27BN2O4/c1-17(2)18(3,4)25-19(24-17)15-12-14(21(22)23)10-11-16(15)20-13-8-6-5-7-9-13/h10-13,20H,5-9H2,1-4H3 |
| InChIKey | SZFLYQWNMRYPPI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|