C13H9F2N3S — CID 162380035
5,6-difluoro-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 162380035) has the molecular formula C13H9F2N3S and a molecular weight of 277.30 g/mol. Its IUPAC name is 5,6-difluoro-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5,6-difluoro-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 162380035 |
| Molecular Formula | C13H9F2N3S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 5,6-difluoro-N-(pyridin-3-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | Fc1cc2nc(NCc3cccnc3)sc2cc1F |
| InChI | InChI=1S/C13H9F2N3S/c14-9-4-11-12(5-10(9)15)19-13(18-11)17-7-8-2-1-3-16-6-8/h1-6H,7H2,(H,17,18) |
| InChIKey | XNIKLFMYAAETEO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |