About 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine
6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 162380241) has the molecular formula C13H13N3OS
and a molecular weight of 259.33 g/mol. Its IUPAC name is 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine |
| PubChem CID | 162380241 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | CCc1ccc2nc(NCc3cnco3)sc2c1 |
| InChI | InChI=1S/C13H13N3OS/c1-2-9-3-4-11-12(5-9)18-13(16-11)15-7-10-6-14-8-17-10/h3-6,8H,2,7H2,1H3,(H,15,16) |
| InChIKey | XWBZLDHQCWDZOS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine?
The IUPAC name of 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine (CID 162380241) is 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine.
What is the SMILES notation for 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine?
The canonical SMILES for 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine is CCc1ccc2nc(NCc3cnco3)sc2c1.
What is the InChIKey of 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine?
The InChIKey is XWBZLDHQCWDZOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3OS/c1-2-9-3-4-11-12(5-9)18-13(16-11)15-7-10-6-14-8-17-10/h3-6,8H,2,7H2,1H3,(H,15,16).
What are the key properties of 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine?
6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine has a molecular weight of 259.33 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N-(1,3-oxazol-5-ylmethyl)-1,3-benzothiazol-2-amine is sourced from PubChem (CID 162380241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).