About 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine
5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine (PubChem CID 162380628) has the molecular formula C14H24BrN5O2
and a molecular weight of 374.28 g/mol. Its IUPAC name is 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine.
Molecular Properties
| Compound Name | 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine |
| PubChem CID | 162380628 |
| Molecular Formula | C14H24BrN5O2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine |
| SMILES | COCC1CCCN1.NC(=O)c1c(NCC2CC2)n[nH]c1Br |
| InChI | InChI=1S/C8H11BrN4O.C6H13NO/c9-6-5(7(10)14)8(13-12-6)11-3-4-1-2-4;1-8-5-6-3-2-4-7-6/h4H,1-3H2,(H2,10,14)(H2,11,12,13);6-7H,2-5H2,1H3 |
| InChIKey | SITGUVDFFVTMLQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine?
The IUPAC name of 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine (CID 162380628) is 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine.
What is the SMILES notation for 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine?
The canonical SMILES for 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine is COCC1CCCN1.NC(=O)c1c(NCC2CC2)n[nH]c1Br.
What is the InChIKey of 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine?
The InChIKey is SITGUVDFFVTMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN4O.C6H13NO/c9-6-5(7(10)14)8(13-12-6)11-3-4-1-2-4;1-8-5-6-3-2-4-7-6/h4H,1-3H2,(H2,10,14)(H2,11,12,13);6-7H,2-5H2,1H3.
What are the key properties of 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine?
5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine has a molecular weight of 374.28 g/mol, XLogP of 1.48, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(cyclopropylmethylamino)-1H-pyrazole-4-carboxamide;2-(methoxymethyl)pyrrolidine is sourced from PubChem (CID 162380628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).