About ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole
ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole (PubChem CID 162380916) has the molecular formula C13H19FN2O
and a molecular weight of 238.31 g/mol. Its IUPAC name is ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole.
Molecular Properties
| Compound Name | ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole |
| PubChem CID | 162380916 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole |
| SMILES | CC.Cc1cc2c(cc1F)N(C1COC1)CN2 |
| InChI | InChI=1S/C11H13FN2O.C2H6/c1-7-2-10-11(3-9(7)12)14(6-13-10)8-4-15-5-8;1-2/h2-3,8,13H,4-6H2,1H3;1-2H3 |
| InChIKey | ZXSOPCXUDSIQPR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole?
The IUPAC name of ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole (CID 162380916) is ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole.
What is the SMILES notation for ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole?
The canonical SMILES for ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole is CC.Cc1cc2c(cc1F)N(C1COC1)CN2.
What is the InChIKey of ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole?
The InChIKey is ZXSOPCXUDSIQPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2O.C2H6/c1-7-2-10-11(3-9(7)12)14(6-13-10)8-4-15-5-8;1-2/h2-3,8,13H,4-6H2,1H3;1-2H3.
What are the key properties of ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole?
ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole has a molecular weight of 238.31 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-fluoro-6-methyl-3-(oxetan-3-yl)-1,2-dihydrobenzimidazole is sourced from PubChem (CID 162380916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).