About 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole
1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole (PubChem CID 162380961) has the molecular formula C10H8F4N2
and a molecular weight of 232.18 g/mol. Its IUPAC name is 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole |
| PubChem CID | 162380961 |
| Molecular Formula | C10H8F4N2 |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole |
| SMILES | Cc1c(F)cc2c(nc(C)n2C(F)F)c1F |
| InChI | InChI=1S/C10H8F4N2/c1-4-6(11)3-7-9(8(4)12)15-5(2)16(7)10(13)14/h3,10H,1-2H3 |
| InChIKey | XJXQUMCTTYYYMZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole?
The IUPAC name of 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole (CID 162380961) is 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole.
What is the SMILES notation for 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole?
The canonical SMILES for 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole is Cc1c(F)cc2c(nc(C)n2C(F)F)c1F.
What is the InChIKey of 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole?
The InChIKey is XJXQUMCTTYYYMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F4N2/c1-4-6(11)3-7-9(8(4)12)15-5(2)16(7)10(13)14/h3,10H,1-2H3.
What are the key properties of 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole?
1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole has a molecular weight of 232.18 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-4,6-difluoro-2,5-dimethylbenzimidazole is sourced from PubChem (CID 162380961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).