About CID 162381137
CID 162381137 (PubChem CID 162381137) has the molecular formula C14H19BrN5O3Si-
and a molecular weight of 413.33 g/mol.
Molecular Properties
| Compound Name | CID 162381137 |
| PubChem CID | 162381137 |
| Molecular Formula | C14H19BrN5O3Si- |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1C[C@@]([Si-])(n2nc(Br)c(C(N)=O)c2NC)C[C@@H]1COC |
| InChI | InChI=1S/C14H19BrN5O3Si/c1-4-9(21)19-7-14(24,5-8(19)6-23-3)20-13(17-2)10(12(16)22)11(15)18-20/h4,8,17H,1,5-7H2,2-3H3,(H2,16,22)/q-1/t8-,14-/m1/s1 |
| InChIKey | GNSPRNJQBBCSOH-XLKFXECMSA-N |
| XLogP | 0.04 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162381137 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162381137?
The IUPAC name of CID 162381137 (CID 162381137) is not available.
What is the SMILES notation for CID 162381137?
The canonical SMILES for CID 162381137 is C=CC(=O)N1C[C@@]([Si-])(n2nc(Br)c(C(N)=O)c2NC)C[C@@H]1COC.
What is the InChIKey of CID 162381137?
The InChIKey is GNSPRNJQBBCSOH-XLKFXECMSA-N. The full InChI is InChI=1S/C14H19BrN5O3Si/c1-4-9(21)19-7-14(24,5-8(19)6-23-3)20-13(17-2)10(12(16)22)11(15)18-20/h4,8,17H,1,5-7H2,2-3H3,(H2,16,22)/q-1/t8-,14-/m1/s1.
What are the key properties of CID 162381137?
CID 162381137 has a molecular weight of 413.33 g/mol, XLogP of 0.04, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162381137 is sourced from PubChem (CID 162381137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).