C16H18F3N5O3 — CID 162381226
3-ethynyl-5-(methylamino)-1-[(3S,5R)-1-prop-2-enoyl-5-(trifluoromethoxymethyl)pyrrolidin-3-yl]pyrazole-4-carboxamide (PubChem CID 162381226) has the molecular formula C16H18F3N5O3 and a molecular weight of 385.35 g/mol. Its IUPAC name is 3-ethynyl-5-(methylamino)-1-[(3S,5R)-1-prop-2-enoyl-5-(trifluoromethoxymethyl)pyrrolidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-ethynyl-5-(methylamino)-1-[(3S,5R)-1-prop-2-enoyl-5-(trifluoromethoxymethyl)pyrrolidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381226 |
| Molecular Formula | C16H18F3N5O3 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-ethynyl-5-(methylamino)-1-[(3S,5R)-1-prop-2-enoyl-5-(trifluoromethoxymethyl)pyrrolidin-3-yl]pyrazole-4-carboxamide |
| SMILES | C#Cc1nn([C@H]2C[C@H](COC(F)(F)F)N(C(=O)C=C)C2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C16H18F3N5O3/c1-4-11-13(14(20)26)15(21-3)24(22-11)9-6-10(8-27-16(17,18)19)23(7-9)12(25)5-2/h1,5,9-10,21H,2,6-8H2,3H3,(H2,20,26)/t9-,10+/m0/s1 |
| InChIKey | CGYLZLGJVHYQJK-VHSXEESVSA-N |
| XLogP | 0.87 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|