About 4-fluoro-5-iodo-1,2-dimethylbenzimidazole
4-fluoro-5-iodo-1,2-dimethylbenzimidazole (PubChem CID 162381268) has the molecular formula C9H8FIN2
and a molecular weight of 290.08 g/mol. Its IUPAC name is 4-fluoro-5-iodo-1,2-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 4-fluoro-5-iodo-1,2-dimethylbenzimidazole |
| PubChem CID | 162381268 |
| Molecular Formula | C9H8FIN2 |
| Molecular Weight | 290.08 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 4-fluoro-5-iodo-1,2-dimethylbenzimidazole |
| SMILES | Cc1nc2c(F)c(I)ccc2n1C |
| InChI | InChI=1S/C9H8FIN2/c1-5-12-9-7(13(5)2)4-3-6(11)8(9)10/h3-4H,1-2H3 |
| InChIKey | IFJKYONPTPWXIM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.08 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-5-iodo-1,2-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-5-iodo-1,2-dimethylbenzimidazole?
The IUPAC name of 4-fluoro-5-iodo-1,2-dimethylbenzimidazole (CID 162381268) is 4-fluoro-5-iodo-1,2-dimethylbenzimidazole.
What is the SMILES notation for 4-fluoro-5-iodo-1,2-dimethylbenzimidazole?
The canonical SMILES for 4-fluoro-5-iodo-1,2-dimethylbenzimidazole is Cc1nc2c(F)c(I)ccc2n1C.
What is the InChIKey of 4-fluoro-5-iodo-1,2-dimethylbenzimidazole?
The InChIKey is IFJKYONPTPWXIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FIN2/c1-5-12-9-7(13(5)2)4-3-6(11)8(9)10/h3-4H,1-2H3.
What are the key properties of 4-fluoro-5-iodo-1,2-dimethylbenzimidazole?
4-fluoro-5-iodo-1,2-dimethylbenzimidazole has a molecular weight of 290.08 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-5-iodo-1,2-dimethylbenzimidazole is sourced from PubChem (CID 162381268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).