C26H27FN6O3 — CID 162381485
3-[2-(6-fluoro-4-methylquinolin-7-yl)ethynyl]-1-[(3S,5R)-5-(methoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide (PubChem CID 162381485) has the molecular formula C26H27FN6O3 and a molecular weight of 490.54 g/mol. Its IUPAC name is 3-[2-(6-fluoro-4-methylquinolin-7-yl)ethynyl]-1-[(3S,5R)-5-(methoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide.
| Compound Name | 3-[2-(6-fluoro-4-methylquinolin-7-yl)ethynyl]-1-[(3S,5R)-5-(methoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381485 |
| Molecular Formula | C26H27FN6O3 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 3-[2-(6-fluoro-4-methylquinolin-7-yl)ethynyl]-1-[(3S,5R)-5-(methoxymethyl)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1C[C@@H](n2nc(C#Cc3cc4nccc(C)c4cc3F)c(C(N)=O)c2NC)C[C@@H]1COC |
| InChI | InChI=1S/C26H27FN6O3/c1-5-23(34)32-13-17(11-18(32)14-36-4)33-26(29-3)24(25(28)35)21(31-33)7-6-16-10-22-19(12-20(16)27)15(2)8-9-30-22/h5,8-10,12,17-18,29H,1,11,13-14H2,2-4H3,(H2,28,35)/t17-,18+/m0/s1 |
| InChIKey | KYQRBEARVHLKPS-ZWKOTPCHSA-N |
| XLogP | 2.39 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|