About 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine
6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 162381856) has the molecular formula C6H3FIN3
and a molecular weight of 263.01 g/mol. Its IUPAC name is 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine |
| PubChem CID | 162381856 |
| Molecular Formula | C6H3FIN3 |
| Molecular Weight | 263.01 g/mol |
| Exact Mass | 262.94 |
| IUPAC Name | 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Fc1cn2ncnc2cc1I |
| InChI | InChI=1S/C6H3FIN3/c7-4-2-11-6(1-5(4)8)9-3-10-11/h1-3H |
| InChIKey | TWNJQARHJCDMEH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.01 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine?
The IUPAC name of 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine (CID 162381856) is 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine.
What is the SMILES notation for 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine?
The canonical SMILES for 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine is Fc1cn2ncnc2cc1I.
What is the InChIKey of 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine?
The InChIKey is TWNJQARHJCDMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3FIN3/c7-4-2-11-6(1-5(4)8)9-3-10-11/h1-3H.
What are the key properties of 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine?
6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine has a molecular weight of 263.01 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-7-iodo-[1,2,4]triazolo[1,5-a]pyridine is sourced from PubChem (CID 162381856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).