About CID 162381863
CID 162381863 (PubChem CID 162381863) has the molecular formula C15H17FN5O2Si
and a molecular weight of 346.42 g/mol.
Molecular Properties
| Compound Name | CID 162381863 |
| PubChem CID | 162381863 |
| Molecular Formula | C15H17FN5O2Si |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | — |
| SMILES | C#Cc1nn(C2([Si])C[C@H](CF)N(C(=O)C=C)C2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C15H17FN5O2Si/c1-4-10-12(13(17)23)14(18-3)21(19-10)15(24)6-9(7-16)20(8-15)11(22)5-2/h1,5,9,18H,2,6-8H2,3H3,(H2,17,23)/t9-,15?/m1/s1 |
| InChIKey | LQHVTGFNJQPNBC-WXMRUQJCSA-N |
| XLogP | -0.42 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 162381863 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162381863?
The IUPAC name of CID 162381863 (CID 162381863) is not available.
What is the SMILES notation for CID 162381863?
The canonical SMILES for CID 162381863 is C#Cc1nn(C2([Si])C[C@H](CF)N(C(=O)C=C)C2)c(NC)c1C(N)=O.
What is the InChIKey of CID 162381863?
The InChIKey is LQHVTGFNJQPNBC-WXMRUQJCSA-N. The full InChI is InChI=1S/C15H17FN5O2Si/c1-4-10-12(13(17)23)14(18-3)21(19-10)15(24)6-9(7-16)20(8-15)11(22)5-2/h1,5,9,18H,2,6-8H2,3H3,(H2,17,23)/t9-,15?/m1/s1.
What are the key properties of CID 162381863?
CID 162381863 has a molecular weight of 346.42 g/mol, XLogP of -0.42, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162381863 is sourced from PubChem (CID 162381863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).