About ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine
ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine (PubChem CID 162382237) has the molecular formula C13H23N5
and a molecular weight of 249.36 g/mol. Its IUPAC name is ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine.
Molecular Properties
| Compound Name | ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine |
| PubChem CID | 162382237 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine |
| SMILES | C1CCNC1.CC.Cc1c[nH]c2ncnc(N)c12 |
| InChI | InChI=1S/C7H8N4.C4H9N.C2H6/c1-4-2-9-7-5(4)6(8)10-3-11-7;1-2-4-5-3-1;1-2/h2-3H,1H3,(H3,8,9,10,11);5H,1-4H2;1-2H3 |
| InChIKey | AYBZYUMNHSLBQE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine?
The IUPAC name of ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine (CID 162382237) is ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine.
What is the SMILES notation for ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine?
The canonical SMILES for ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine is C1CCNC1.CC.Cc1c[nH]c2ncnc(N)c12.
What is the InChIKey of ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine?
The InChIKey is AYBZYUMNHSLBQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.C4H9N.C2H6/c1-4-2-9-7-5(4)6(8)10-3-11-7;1-2-4-5-3-1;1-2/h2-3H,1H3,(H3,8,9,10,11);5H,1-4H2;1-2H3.
What are the key properties of ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine?
ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine has a molecular weight of 249.36 g/mol, XLogP of 2.24, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;pyrrolidine is sourced from PubChem (CID 162382237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).