About 5-ethynyl-4,6-difluoro-2-methylindazole
5-ethynyl-4,6-difluoro-2-methylindazole (PubChem CID 162382307) has the molecular formula C10H6F2N2
and a molecular weight of 192.17 g/mol. Its IUPAC name is 5-ethynyl-4,6-difluoro-2-methylindazole.
Molecular Properties
| Compound Name | 5-ethynyl-4,6-difluoro-2-methylindazole |
| PubChem CID | 162382307 |
| Molecular Formula | C10H6F2N2 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 5-ethynyl-4,6-difluoro-2-methylindazole |
| SMILES | C#Cc1c(F)cc2nn(C)cc2c1F |
| InChI | InChI=1S/C10H6F2N2/c1-3-6-8(11)4-9-7(10(6)12)5-14(2)13-9/h1,4-5H,2H3 |
| InChIKey | ZCWOWYOROQBTPM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-4,6-difluoro-2-methylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-4,6-difluoro-2-methylindazole?
The IUPAC name of 5-ethynyl-4,6-difluoro-2-methylindazole (CID 162382307) is 5-ethynyl-4,6-difluoro-2-methylindazole.
What is the SMILES notation for 5-ethynyl-4,6-difluoro-2-methylindazole?
The canonical SMILES for 5-ethynyl-4,6-difluoro-2-methylindazole is C#Cc1c(F)cc2nn(C)cc2c1F.
What is the InChIKey of 5-ethynyl-4,6-difluoro-2-methylindazole?
The InChIKey is ZCWOWYOROQBTPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2N2/c1-3-6-8(11)4-9-7(10(6)12)5-14(2)13-9/h1,4-5H,2H3.
What are the key properties of 5-ethynyl-4,6-difluoro-2-methylindazole?
5-ethynyl-4,6-difluoro-2-methylindazole has a molecular weight of 192.17 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-4,6-difluoro-2-methylindazole is sourced from PubChem (CID 162382307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).