About CID 162382667
CID 162382667 (PubChem CID 162382667) has the molecular formula C20H14GaN2O2
and a molecular weight of 384.07 g/mol.
Molecular Properties
| Compound Name | CID 162382667 |
| PubChem CID | 162382667 |
| Molecular Formula | C20H14GaN2O2 |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | — |
| SMILES | C1=N/c2ccccc2/N=C/c2ccccc2O[Ga]Oc2ccccc2/1 |
| InChI | InChI=1S/C20H16N2O2.Ga/c23-19-11-5-1-7-15(19)13-21-17-9-3-4-10-18(17)22-14-16-8-2-6-12-20(16)24;/h1-14,23-24H;/q;+2/p-2/b21-13+,22-14+; |
| InChIKey | CQENKWBDRYROKB-JKBLJYNNSA-L |
| XLogP | 4.49 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 162382667 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162382667?
The IUPAC name of CID 162382667 (CID 162382667) is not available.
What is the SMILES notation for CID 162382667?
The canonical SMILES for CID 162382667 is C1=N/c2ccccc2/N=C/c2ccccc2O[Ga]Oc2ccccc2/1.
What is the InChIKey of CID 162382667?
The InChIKey is CQENKWBDRYROKB-JKBLJYNNSA-L. The full InChI is InChI=1S/C20H16N2O2.Ga/c23-19-11-5-1-7-15(19)13-21-17-9-3-4-10-18(17)22-14-16-8-2-6-12-20(16)24;/h1-14,23-24H;/q;+2/p-2/b21-13+,22-14+;.
What are the key properties of CID 162382667?
CID 162382667 has a molecular weight of 384.07 g/mol, XLogP of 4.49, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162382667 is sourced from PubChem (CID 162382667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).