C30H49N — CID 162382704
ethane;(2Z)-5-(3-methyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-prop-2-enylideneheptan-1-imine (PubChem CID 162382704) has the molecular formula C30H49N and a molecular weight of 423.73 g/mol. Its IUPAC name is ethane;(2Z)-5-(3-methyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-prop-2-enylideneheptan-1-imine.
| Compound Name | ethane;(2Z)-5-(3-methyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-prop-2-enylideneheptan-1-imine |
|---|---|
| PubChem CID | 162382704 |
| Molecular Formula | C30H49N |
| Molecular Weight | 423.73 g/mol |
| Exact Mass | 423.39 |
| IUPAC Name | ethane;(2Z)-5-(3-methyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-prop-2-enylideneheptan-1-imine |
| SMILES | CC.[H]/N=C/C(=C\C=C)CCC(CC)C1CCC2C1CCC1C3CCC(C)CC3=CCC12 |
| InChI | InChI=1S/C28H43N.C2H6/c1-4-6-20(18-29)8-9-21(5-2)23-13-14-28-25(23)15-16-26-24-11-7-19(3)17-22(24)10-12-27(26)28;1-2/h4,6,10,18-19,21,23-29H,1,5,7-9,11-17H2,2-3H3;1-2H3/b20-6-,29-18+; |
| InChIKey | CJFGTEXVXWFXIU-LTSFPCCESA-N |
| XLogP | 9.02 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.73 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|