C10H23FN2 — CID 162382785
1-N-ethyl-2-N-fluoro-2-N-propylpentane-1,2-diamine (PubChem CID 162382785) has the molecular formula C10H23FN2 and a molecular weight of 190.31 g/mol. Its IUPAC name is 1-N-ethyl-2-N-fluoro-2-N-propylpentane-1,2-diamine.
| Compound Name | 1-N-ethyl-2-N-fluoro-2-N-propylpentane-1,2-diamine |
|---|---|
| PubChem CID | 162382785 |
| Molecular Formula | C10H23FN2 |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.18 |
| IUPAC Name | 1-N-ethyl-2-N-fluoro-2-N-propylpentane-1,2-diamine |
| SMILES | CCCC(CNCC)N(F)CCC |
| InChI | InChI=1S/C10H23FN2/c1-4-7-10(9-12-6-3)13(11)8-5-2/h10,12H,4-9H2,1-3H3 |
| InChIKey | PKKRAKWUQIYWMM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|