C31H44FN8O2+ — CID 162382870
[6-amino-2-[4-[7-(2-fluoropropanoyl)-4,7-diazaspiro[2.5]octan-4-yl]-2-[(1-methylpyrrolidin-2-yl)methoxy]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-methylphenyl]methylideneazanium (PubChem CID 162382870) has the molecular formula C31H44FN8O2+ and a molecular weight of 579.75 g/mol. Its IUPAC name is [6-amino-2-[4-[7-(2-fluoropropanoyl)-4,7-diazaspiro[2.5]octan-4-yl]-2-[(1-methylpyrrolidin-2-yl)methoxy]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-methylphenyl]methylideneazanium.
| Compound Name | [6-amino-2-[4-[7-(2-fluoropropanoyl)-4,7-diazaspiro[2.5]octan-4-yl]-2-[(1-methylpyrrolidin-2-yl)methoxy]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-methylphenyl]methylideneazanium |
|---|---|
| PubChem CID | 162382870 |
| Molecular Formula | C31H44FN8O2+ |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.36 |
| IUPAC Name | [6-amino-2-[4-[7-(2-fluoropropanoyl)-4,7-diazaspiro[2.5]octan-4-yl]-2-[(1-methylpyrrolidin-2-yl)methoxy]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-methylphenyl]methylideneazanium |
| SMILES | Cc1ccc(N)c(C=[NH2+])c1N1CCc2nc(OCC3CCCN3C)nc(N3CCN(C(=O)C(C)F)CC34CC4)c2CC1 |
| InChI | InChI=1S/C31H43FN8O2/c1-20-6-7-25(34)24(17-33)27(20)38-13-8-23-26(9-14-38)35-30(42-18-22-5-4-12-37(22)3)36-28(23)40-16-15-39(29(41)21(2)32)19-31(40)10-11-31/h6-7,17,21-22,33H,4-5,8-16,18-19,34H2,1-3H3/p+1 |
| InChIKey | NCCYVBZTKLQPAL-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|