About 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol
1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol (PubChem CID 162383328) has the molecular formula C16H16ClF3NO3P
and a molecular weight of 393.73 g/mol. Its IUPAC name is 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol.
Molecular Properties
| Compound Name | 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol |
| PubChem CID | 162383328 |
| Molecular Formula | C16H16ClF3NO3P |
| Molecular Weight | 393.73 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol |
| SMILES | COP(OC)c1cn(-c2cc(F)cc(Cl)c2)c2c1C(O)C(F)(F)CC2 |
| InChI | InChI=1S/C16H16ClF3NO3P/c1-23-25(24-2)13-8-21(11-6-9(17)5-10(18)7-11)12-3-4-16(19,20)15(22)14(12)13/h5-8,15,22H,3-4H2,1-2H3 |
| InChIKey | SMHDDCHHWRRYQQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.73 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol?
The IUPAC name of 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol (CID 162383328) is 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol.
What is the SMILES notation for 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol?
The canonical SMILES for 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol is COP(OC)c1cn(-c2cc(F)cc(Cl)c2)c2c1C(O)C(F)(F)CC2.
What is the InChIKey of 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol?
The InChIKey is SMHDDCHHWRRYQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClF3NO3P/c1-23-25(24-2)13-8-21(11-6-9(17)5-10(18)7-11)12-3-4-16(19,20)15(22)14(12)13/h5-8,15,22H,3-4H2,1-2H3.
What are the key properties of 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol?
1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol has a molecular weight of 393.73 g/mol, XLogP of 4.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-5-fluorophenyl)-3-dimethoxyphosphanyl-5,5-difluoro-6,7-dihydro-4H-indol-4-ol is sourced from PubChem (CID 162383328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).