C15H9F8NO — CID 162383357
7,7-difluoro-1-(trifluoromethyl)-3-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-indolizin-8-ol (PubChem CID 162383357) has the molecular formula C15H9F8NO and a molecular weight of 371.23 g/mol. Its IUPAC name is 7,7-difluoro-1-(trifluoromethyl)-3-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-indolizin-8-ol.
| Compound Name | 7,7-difluoro-1-(trifluoromethyl)-3-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-indolizin-8-ol |
|---|---|
| PubChem CID | 162383357 |
| Molecular Formula | C15H9F8NO |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 7,7-difluoro-1-(trifluoromethyl)-3-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-indolizin-8-ol |
| SMILES | OC1c2c(C(F)(F)F)cc(-c3cc(F)c(F)c(F)c3)n2CCC1(F)F |
| InChI | InChI=1S/C15H9F8NO/c16-8-3-6(4-9(17)11(8)18)10-5-7(15(21,22)23)12-13(25)14(19,20)1-2-24(10)12/h3-5,13,25H,1-2H2 |
| InChIKey | WZWRKIBADCJSDG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|