About 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol
1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol (PubChem CID 162383421) has the molecular formula C15H12F5NO3S
and a molecular weight of 381.32 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol |
| PubChem CID | 162383421 |
| Molecular Formula | C15H12F5NO3S |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol |
| SMILES | O=S(=O)(c1ccccc1)n1cc(C(F)(F)F)c2c1CCC(F)(F)C2O |
| InChI | InChI=1S/C15H12F5NO3S/c16-14(17)7-6-11-12(13(14)22)10(15(18,19)20)8-21(11)25(23,24)9-4-2-1-3-5-9/h1-5,8,13,22H,6-7H2 |
| InChIKey | QBDUOCZKUFASIV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol?
The IUPAC name of 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol (CID 162383421) is 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol.
What is the SMILES notation for 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol?
The canonical SMILES for 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol is O=S(=O)(c1ccccc1)n1cc(C(F)(F)F)c2c1CCC(F)(F)C2O.
What is the InChIKey of 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol?
The InChIKey is QBDUOCZKUFASIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F5NO3S/c16-14(17)7-6-11-12(13(14)22)10(15(18,19)20)8-21(11)25(23,24)9-4-2-1-3-5-9/h1-5,8,13,22H,6-7H2.
What are the key properties of 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol?
1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol has a molecular weight of 381.32 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-5,5-difluoro-3-(trifluoromethyl)-6,7-dihydro-4H-indol-4-ol is sourced from PubChem (CID 162383421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).