C26H26F2N6O3 — CID 162383996
4-(2-aminoethoxymethyl)-1-[4-[[3-[4-(difluoromethoxy)phenyl]imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]pyrrolidin-2-one (PubChem CID 162383996) has the molecular formula C26H26F2N6O3 and a molecular weight of 508.53 g/mol. Its IUPAC name is 4-(2-aminoethoxymethyl)-1-[4-[[3-[4-(difluoromethoxy)phenyl]imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]pyrrolidin-2-one.
| Compound Name | 4-(2-aminoethoxymethyl)-1-[4-[[3-[4-(difluoromethoxy)phenyl]imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 162383996 |
| Molecular Formula | C26H26F2N6O3 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 4-(2-aminoethoxymethyl)-1-[4-[[3-[4-(difluoromethoxy)phenyl]imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]pyrrolidin-2-one |
| SMILES | NCCOCC1CC(=O)N(c2ccc(Nc3nccn4c(-c5ccc(OC(F)F)cc5)cnc34)cc2)C1 |
| InChI | InChI=1S/C26H26F2N6O3/c27-26(28)37-21-7-1-18(2-8-21)22-14-31-25-24(30-10-11-33(22)25)32-19-3-5-20(6-4-19)34-15-17(13-23(34)35)16-36-12-9-29/h1-8,10-11,14,17,26H,9,12-13,15-16,29H2,(H,30,32) |
| InChIKey | NHINPUNFEHXBBZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|