C31H33ClF5N7O4 — CID 162384899
2-chloro-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl]-N-methylbenzamide;2,2,2-trifluoroacetate (PubChem CID 162384899) has the molecular formula C31H33ClF5N7O4 and a molecular weight of 698.09 g/mol. Its IUPAC name is 2-chloro-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl]-N-methylbenzamide;2,2,2-trifluoroacetate.
| Compound Name | 2-chloro-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl]-N-methylbenzamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162384899 |
| Molecular Formula | C31H33ClF5N7O4 |
| Molecular Weight | 698.09 g/mol |
| Exact Mass | 697.22 |
| IUPAC Name | 2-chloro-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethyl]-N-methylbenzamide;2,2,2-trifluoroacetate |
| SMILES | COc1ccc(-c2cnc3c(Nc4ccc(C(=O)N(C)CCN5CC[N+](C)(C)CC5)c(Cl)c4)nccn23)c(F)c1F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C29H32ClF2N7O2.C2HF3O2/c1-36(11-12-37-13-15-39(2,3)16-14-37)29(40)20-6-5-19(17-22(20)30)35-27-28-34-18-23(38(28)10-9-33-27)21-7-8-24(41-4)26(32)25(21)31;3-2(4,5)1(6)7/h5-10,17-18H,11-16H2,1-4H3;(H,6,7) |
| InChIKey | DCCQPQSEIBSUNV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.09 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|