About 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane
3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane (PubChem CID 162386122) has the molecular formula C21H24BrFN2O
and a molecular weight of 419.34 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane.
Molecular Properties
| Compound Name | 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane |
| PubChem CID | 162386122 |
| Molecular Formula | C21H24BrFN2O |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane |
| SMILES | CC.CCc1nc2cc(F)c(C)cc2c(=O)n1-c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C19H18BrFN2O.C2H6/c1-5-17-22-16-9-15(21)10(2)8-14(16)19(24)23(17)18-11(3)6-13(20)7-12(18)4;1-2/h6-9H,5H2,1-4H3;1-2H3 |
| InChIKey | PESPJYXIAUMWMS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane?
The IUPAC name of 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane (CID 162386122) is 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane.
What is the SMILES notation for 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane?
The canonical SMILES for 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane is CC.CCc1nc2cc(F)c(C)cc2c(=O)n1-c1c(C)cc(Br)cc1C.
What is the InChIKey of 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane?
The InChIKey is PESPJYXIAUMWMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18BrFN2O.C2H6/c1-5-17-22-16-9-15(21)10(2)8-14(16)19(24)23(17)18-11(3)6-13(20)7-12(18)4;1-2/h6-9H,5H2,1-4H3;1-2H3.
What are the key properties of 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane?
3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane has a molecular weight of 419.34 g/mol, XLogP of 5.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-2,6-dimethylphenyl)-2-ethyl-7-fluoro-6-methylquinazolin-4-one;ethane is sourced from PubChem (CID 162386122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).