C10H6Cl2FN3O2 — CID 162386444
methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate (PubChem CID 162386444) has the molecular formula C10H6Cl2FN3O2 and a molecular weight of 290.08 g/mol. Its IUPAC name is methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate.
| Compound Name | methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162386444 |
| Molecular Formula | C10H6Cl2FN3O2 |
| Molecular Weight | 290.08 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate |
| SMILES | COC(=O)C(=Cc1cc(F)c(Cl)cc1Cl)N=[N+]=[N-] |
| InChI | InChI=1S/C10H6Cl2FN3O2/c1-18-10(17)9(15-16-14)3-5-2-8(13)7(12)4-6(5)11/h2-4H,1H3 |
| InChIKey | QJFHCNZXGROCEH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.08 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|