methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate

C10H6Cl2FN3O2 — CID 162386444

IUPACmethyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate
SMILESCOC(=O)C(=Cc1cc(F)c(Cl)cc1Cl)N=[N+]=[N-]
InChIInChI=1S/C10H6Cl2FN3O2/c1-18-10(17)9(15-16-14)3-5-2-8(13)7(12)4-6(5)11/h2-4H,1H3
InChIKeyQJFHCNZXGROCEH-UHFFFAOYSA-N
MW290.08 g/mol
LogP3.96
Rot. Bonds3

About methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate

methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate (PubChem CID 162386444) has the molecular formula C10H6Cl2FN3O2 and a molecular weight of 290.08 g/mol. Its IUPAC name is methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate.

Molecular Properties

Compound Namemethyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate
PubChem CID162386444
Molecular FormulaC10H6Cl2FN3O2
Molecular Weight290.08 g/mol
Exact Mass288.98
IUPAC Namemethyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate
SMILESCOC(=O)C(=Cc1cc(F)c(Cl)cc1Cl)N=[N+]=[N-]
InChIInChI=1S/C10H6Cl2FN3O2/c1-18-10(17)9(15-16-14)3-5-2-8(13)7(12)4-6(5)11/h2-4H,1H3
InChIKeyQJFHCNZXGROCEH-UHFFFAOYSA-N
XLogP3.96
TPSA75.06 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.08
LogP ≤ 53.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate?
The IUPAC name of methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate (CID 162386444) is methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate.
What is the SMILES notation for methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate?
The canonical SMILES for methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate is COC(=O)C(=Cc1cc(F)c(Cl)cc1Cl)N=[N+]=[N-].
What is the InChIKey of methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate?
The InChIKey is QJFHCNZXGROCEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2FN3O2/c1-18-10(17)9(15-16-14)3-5-2-8(13)7(12)4-6(5)11/h2-4H,1H3.
What are the key properties of methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate?
methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate has a molecular weight of 290.08 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-azido-3-(2,4-dichloro-5-fluorophenyl)prop-2-enoate is sourced from PubChem (CID 162386444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).