About 1,1-diethylcyclopropane;ethane;propane
1,1-diethylcyclopropane;ethane;propane (PubChem CID 162386463) has the molecular formula C12H28
and a molecular weight of 172.36 g/mol. Its IUPAC name is 1,1-diethylcyclopropane;ethane;propane.
Molecular Properties
| Compound Name | 1,1-diethylcyclopropane;ethane;propane |
| PubChem CID | 162386463 |
| Molecular Formula | C12H28 |
| Molecular Weight | 172.36 g/mol |
| Exact Mass | 172.22 |
| IUPAC Name | 1,1-diethylcyclopropane;ethane;propane |
| SMILES | CC.CCC.CCC1(CC)CC1 |
| InChI | InChI=1S/C7H14.C3H8.C2H6/c1-3-7(4-2)5-6-7;1-3-2;1-2/h3-6H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | CKCBEWVZRMIYCN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 172.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-diethylcyclopropane;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethylcyclopropane;ethane;propane?
The IUPAC name of 1,1-diethylcyclopropane;ethane;propane (CID 162386463) is 1,1-diethylcyclopropane;ethane;propane.
What is the SMILES notation for 1,1-diethylcyclopropane;ethane;propane?
The canonical SMILES for 1,1-diethylcyclopropane;ethane;propane is CC.CCC.CCC1(CC)CC1.
What is the InChIKey of 1,1-diethylcyclopropane;ethane;propane?
The InChIKey is CKCBEWVZRMIYCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C3H8.C2H6/c1-3-7(4-2)5-6-7;1-3-2;1-2/h3-6H2,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of 1,1-diethylcyclopropane;ethane;propane?
1,1-diethylcyclopropane;ethane;propane has a molecular weight of 172.36 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethylcyclopropane;ethane;propane is sourced from PubChem (CID 162386463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).