About 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine
1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine (PubChem CID 162386735) has the molecular formula C11H25F2N3
and a molecular weight of 237.34 g/mol. Its IUPAC name is 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine |
| PubChem CID | 162386735 |
| Molecular Formula | C11H25F2N3 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine |
| SMILES | CCN(C)C.CNCN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H14F2N2.C4H11N/c1-10-6-11-4-2-7(8,9)3-5-11;1-4-5(2)3/h10H,2-6H2,1H3;4H2,1-3H3 |
| InChIKey | PZBJVSXAPGNXJW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine?
The IUPAC name of 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine (CID 162386735) is 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine.
What is the SMILES notation for 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine?
The canonical SMILES for 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine is CCN(C)C.CNCN1CCC(F)(F)CC1.
What is the InChIKey of 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine?
The InChIKey is PZBJVSXAPGNXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F2N2.C4H11N/c1-10-6-11-4-2-7(8,9)3-5-11;1-4-5(2)3/h10H,2-6H2,1H3;4H2,1-3H3.
What are the key properties of 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine?
1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine has a molecular weight of 237.34 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluoropiperidin-1-yl)-N-methylmethanamine;N,N-dimethylethanamine is sourced from PubChem (CID 162386735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).