C17H34N2O3 — CID 162387958
acetamide;acetylene;N-(2-hydroxypentyl)octanamide (PubChem CID 162387958) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is acetamide;acetylene;N-(2-hydroxypentyl)octanamide.
| Compound Name | acetamide;acetylene;N-(2-hydroxypentyl)octanamide |
|---|---|
| PubChem CID | 162387958 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | acetamide;acetylene;N-(2-hydroxypentyl)octanamide |
| SMILES | C#C.CC(N)=O.CCCCCCCC(=O)NCC(O)CCC |
| InChI | InChI=1S/C13H27NO2.C2H5NO.C2H2/c1-3-5-6-7-8-10-13(16)14-11-12(15)9-4-2;1-2(3)4;1-2/h12,15H,3-11H2,1-2H3,(H,14,16);1H3,(H2,3,4);1-2H |
| InChIKey | IEKHPJBFSISTAE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|