C11H14N4 — CID 162388544
(4S)-N,N-dimethyl-7,9,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-4-amine (PubChem CID 162388544) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is (4S)-N,N-dimethyl-7,9,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-4-amine.
| Compound Name | (4S)-N,N-dimethyl-7,9,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-4-amine |
|---|---|
| PubChem CID | 162388544 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (4S)-N,N-dimethyl-7,9,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-4-amine |
| SMILES | CN(C)[C@@H]1Cc2[nH]c3nccnc3c2C1 |
| InChI | InChI=1S/C11H14N4/c1-15(2)7-5-8-9(6-7)14-11-10(8)12-3-4-13-11/h3-4,7H,5-6H2,1-2H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | HQKFVNJWHUQEBX-ZETCQYMHSA-N |
| XLogP | 0.99 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |