C11H13N3 — CID 162388606
4,6,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraene (PubChem CID 162388606) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 4,6,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraene.
| Compound Name | 4,6,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraene |
|---|---|
| PubChem CID | 162388606 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 4,6,8-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraene |
| SMILES | c1ncc2c3c([nH]c2n1)CCCCC3 |
| InChI | InChI=1S/C11H13N3/c1-2-4-8-9-6-12-7-13-11(9)14-10(8)5-3-1/h6-7H,1-5H2,(H,12,13,14) |
| InChIKey | QDJYCGCTGCHVPK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |