C11H14N4 — CID 162388610
3,11-dimethyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene (PubChem CID 162388610) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 3,11-dimethyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene.
| Compound Name | 3,11-dimethyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene |
|---|---|
| PubChem CID | 162388610 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3,11-dimethyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene |
| SMILES | Cc1ncnc2[nH]c3c(c12)CCN(C)C3 |
| InChI | InChI=1S/C11H14N4/c1-7-10-8-3-4-15(2)5-9(8)14-11(10)13-6-12-7/h6H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | FXDIGHPYGADPNC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |