About N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine
N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine (PubChem CID 162389238) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine.
Molecular Properties
| Compound Name | N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine |
| PubChem CID | 162389238 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine |
| SMILES | C=C/C=C(\C)N(C)C1CC(N2CCCCC2)C1 |
| InChI | InChI=1S/C15H26N2/c1-4-8-13(2)16(3)14-11-15(12-14)17-9-6-5-7-10-17/h4,8,14-15H,1,5-7,9-12H2,2-3H3/b13-8+ |
| InChIKey | ZKOMZZSQMQUZLO-MDWZMJQESA-N |
| XLogP | 3.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine?
The IUPAC name of N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine (CID 162389238) is N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine.
What is the SMILES notation for N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine?
The canonical SMILES for N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine is C=C/C=C(\C)N(C)C1CC(N2CCCCC2)C1.
What is the InChIKey of N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine?
The InChIKey is ZKOMZZSQMQUZLO-MDWZMJQESA-N. The full InChI is InChI=1S/C15H26N2/c1-4-8-13(2)16(3)14-11-15(12-14)17-9-6-5-7-10-17/h4,8,14-15H,1,5-7,9-12H2,2-3H3/b13-8+.
What are the key properties of N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine?
N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine has a molecular weight of 234.39 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(2E)-penta-2,4-dien-2-yl]-3-piperidin-1-ylcyclobutan-1-amine is sourced from PubChem (CID 162389238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).