About [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine
[3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine (PubChem CID 162389639) has the molecular formula C19H17ClF2N2
and a molecular weight of 346.81 g/mol. Its IUPAC name is [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine.
Molecular Properties
| Compound Name | [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine |
| PubChem CID | 162389639 |
| Molecular Formula | C19H17ClF2N2 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine |
| SMILES | NCC1CC(c2c(-c3ccc(Cl)cc3)[nH]c3c(F)cc(F)cc23)C1 |
| InChI | InChI=1S/C19H17ClF2N2/c20-13-3-1-11(2-4-13)18-17(12-5-10(6-12)9-23)15-7-14(21)8-16(22)19(15)24-18/h1-4,7-8,10,12,24H,5-6,9,23H2 |
| InChIKey | CWYVEKCROONLLC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine?
The IUPAC name of [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine (CID 162389639) is [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine.
What is the SMILES notation for [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine?
The canonical SMILES for [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine is NCC1CC(c2c(-c3ccc(Cl)cc3)[nH]c3c(F)cc(F)cc23)C1.
What is the InChIKey of [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine?
The InChIKey is CWYVEKCROONLLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClF2N2/c20-13-3-1-11(2-4-13)18-17(12-5-10(6-12)9-23)15-7-14(21)8-16(22)19(15)24-18/h1-4,7-8,10,12,24H,5-6,9,23H2.
What are the key properties of [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine?
[3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine has a molecular weight of 346.81 g/mol, XLogP of 5.22, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(4-chlorophenyl)-5,7-difluoro-1H-indol-3-yl]cyclobutyl]methanamine is sourced from PubChem (CID 162389639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).