C21H22F2N2 — CID 162389852
1-[3-[7-fluoro-2-(4-fluorophenyl)-5-methyl-1H-indol-3-yl]cyclobutyl]-N-methylmethanamine (PubChem CID 162389852) has the molecular formula C21H22F2N2 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[3-[7-fluoro-2-(4-fluorophenyl)-5-methyl-1H-indol-3-yl]cyclobutyl]-N-methylmethanamine.
| Compound Name | 1-[3-[7-fluoro-2-(4-fluorophenyl)-5-methyl-1H-indol-3-yl]cyclobutyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 162389852 |
| Molecular Formula | C21H22F2N2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[3-[7-fluoro-2-(4-fluorophenyl)-5-methyl-1H-indol-3-yl]cyclobutyl]-N-methylmethanamine |
| SMILES | CNCC1CC(c2c(-c3ccc(F)cc3)[nH]c3c(F)cc(C)cc23)C1 |
| InChI | InChI=1S/C21H22F2N2/c1-12-7-17-19(15-9-13(10-15)11-24-2)20(25-21(17)18(23)8-12)14-3-5-16(22)6-4-14/h3-8,13,15,24-25H,9-11H2,1-2H3 |
| InChIKey | MTEFGWJOFNHRSK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |