C31H32F3N3O3S — CID 162389893
N-(cyclobutylmethyl)-2-(1,3-dioxoisoindol-2-yl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane (PubChem CID 162389893) has the molecular formula C31H32F3N3O3S and a molecular weight of 583.68 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2-(1,3-dioxoisoindol-2-yl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane.
| Compound Name | N-(cyclobutylmethyl)-2-(1,3-dioxoisoindol-2-yl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane |
|---|---|
| PubChem CID | 162389893 |
| Molecular Formula | C31H32F3N3O3S |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | N-(cyclobutylmethyl)-2-(1,3-dioxoisoindol-2-yl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane |
| SMILES | CC.Fc1ccc(-c2cc3cc(F)cc(F)c3[nH]2)cc1.O=C1c2ccccc2C(=O)N1CCS(=O)NCC1CCC1 |
| InChI | InChI=1S/C15H18N2O3S.C14H8F3N.C2H6/c18-14-12-6-1-2-7-13(12)15(19)17(14)8-9-21(20)16-10-11-4-3-5-11;15-10-3-1-8(2-4-10)13-6-9-5-11(16)7-12(17)14(9)18-13;1-2/h1-2,6-7,11,16H,3-5,8-10H2;1-7,18H;1-2H3 |
| InChIKey | CRCNFCJSAXAPFL-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|