C28H53N3O7 — CID 162390373
(3S,6R,8R,9R,10R)-9-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-4,6,8,10,12,12-hexamethyl-3-(methylaminomethyl)-1-oxa-4-azacyclotridecane-11,13-dione (PubChem CID 162390373) has the molecular formula C28H53N3O7 and a molecular weight of 543.75 g/mol. Its IUPAC name is (3S,6R,8R,9R,10R)-9-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-4,6,8,10,12,12-hexamethyl-3-(methylaminomethyl)-1-oxa-4-azacyclotridecane-11,13-dione.
| Compound Name | (3S,6R,8R,9R,10R)-9-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-4,6,8,10,12,12-hexamethyl-3-(methylaminomethyl)-1-oxa-4-azacyclotridecane-11,13-dione |
|---|---|
| PubChem CID | 162390373 |
| Molecular Formula | C28H53N3O7 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.39 |
| IUPAC Name | (3S,6R,8R,9R,10R)-9-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-4,6,8,10,12,12-hexamethyl-3-(methylaminomethyl)-1-oxa-4-azacyclotridecane-11,13-dione |
| SMILES | CNC[C@H]1COC(=O)C(C)(C)C(=O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@](C)(OC)C[C@@H](C)CN1C |
| InChI | InChI=1S/C28H53N3O7/c1-17-13-28(6,35-11)24(38-25-22(32)21(30(8)9)12-18(2)37-25)19(3)23(33)27(4,5)26(34)36-16-20(14-29-7)31(10)15-17/h17-22,24-25,29,32H,12-16H2,1-11H3/t17-,18-,19+,20+,21+,22-,24-,25+,28-/m1/s1 |
| InChIKey | NRDLWIIIIUOBDN-QUQZWAPMSA-N |
| XLogP | 1.54 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|