C23H26N6O2 — CID 162390605
5-(2-methoxy-4-pyridinyl)-2-[6-[(3-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)amino]-1,2,4-triazin-3-yl]phenol (PubChem CID 162390605) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-(2-methoxy-4-pyridinyl)-2-[6-[(3-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)amino]-1,2,4-triazin-3-yl]phenol.
| Compound Name | 5-(2-methoxy-4-pyridinyl)-2-[6-[(3-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)amino]-1,2,4-triazin-3-yl]phenol |
|---|---|
| PubChem CID | 162390605 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 5-(2-methoxy-4-pyridinyl)-2-[6-[(3-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)amino]-1,2,4-triazin-3-yl]phenol |
| SMILES | COc1cc(-c2ccc(-c3ncc(NC4CC5CNC(C)C5C4)nn3)c(O)c2)ccn1 |
| InChI | InChI=1S/C23H26N6O2/c1-13-19-10-17(7-16(19)11-25-13)27-21-12-26-23(29-28-21)18-4-3-14(8-20(18)30)15-5-6-24-22(9-15)31-2/h3-6,8-9,12-13,16-17,19,25,30H,7,10-11H2,1-2H3,(H,27,28) |
| InChIKey | TWJAYVQHNXCUBJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |