C23H25FN6O2 — CID 162390636
4-[4-[6-[[(1S,2S,3R,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one (PubChem CID 162390636) has the molecular formula C23H25FN6O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 4-[4-[6-[[(1S,2S,3R,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one.
| Compound Name | 4-[4-[6-[[(1S,2S,3R,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 162390636 |
| Molecular Formula | C23H25FN6O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-[4-[6-[[(1S,2S,3R,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one |
| SMILES | CN(c1cnc(-c2ccc(-c3ccn(C)c(=O)c3)cc2O)nn1)[C@@H]1C[C@H]2CC[C@H](N2)[C@@H]1F |
| InChI | InChI=1S/C23H25FN6O2/c1-29-8-7-14(10-21(29)32)13-3-5-16(19(31)9-13)23-25-12-20(27-28-23)30(2)18-11-15-4-6-17(26-15)22(18)24/h3,5,7-10,12,15,17-18,22,26,31H,4,6,11H2,1-2H3/t15-,17+,18-,22+/m1/s1 |
| InChIKey | QSZWWEACKIXLEQ-WHEACTPUSA-N |
| XLogP | 2.28 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |