C16H16Cl2FN3OS — CID 162390927
2-[(2S)-2-amino-4-fluorobutyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 162390927) has the molecular formula C16H16Cl2FN3OS and a molecular weight of 388.30 g/mol. Its IUPAC name is 2-[(2S)-2-amino-4-fluorobutyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2S)-2-amino-4-fluorobutyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 162390927 |
| Molecular Formula | C16H16Cl2FN3OS |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 2-[(2S)-2-amino-4-fluorobutyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@@H](CCF)Cc1sc2c(NCc3ccco3)cc(Cl)nc2c1Cl |
| InChI | InChI=1S/C16H16Cl2FN3OS/c17-13-7-11(21-8-10-2-1-5-23-10)16-15(22-13)14(18)12(24-16)6-9(20)3-4-19/h1-2,5,7,9H,3-4,6,8,20H2,(H,21,22)/t9-/m0/s1 |
| InChIKey | SYEABLNUALSJJI-VIFPVBQESA-N |
| XLogP | 5.04 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|